C60H53GeIrN3O-2 — CID 156658638
CID 156658638 (PubChem CID 156658638) has the molecular formula C60H53GeIrN3O-2 and a molecular weight of 1099.95 g/mol.
| Compound Name | CID 156658638 |
|---|---|
| PubChem CID | 156658638 |
| Molecular Formula | C60H53GeIrN3O-2 |
| Molecular Weight | 1099.95 g/mol |
| Exact Mass | 1101.32 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4ccc5ccccc5c4cc23)nc2ccccc21.[2H]C([2H])([2H])c1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir] |
| InChI | InChI=1S/C45H35N2O.C15H18GeN.Ir/c1-27(2)36-23-32(29-13-6-5-7-14-29)24-37(28(3)4)43(36)47-41-20-11-10-19-40(41)46-45(47)35-18-12-17-34-39-26-38-31(25-42(39)48-44(34)35)22-21-30-15-8-9-16-33(30)38;1-12-10-15(13-8-6-5-7-9-13)17-11-14(12)16(2,3)4;/h5-17,19-28H,1-4H3;5-8,10-11H,1-4H3;/q2*-1;/i;1D3; |
| InChIKey | JYNUVGREFVOJLT-ICMJTWPQSA-N |
| XLogP | 16.01 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.95 |
| LogP ≤ 5 | 16.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|