C73H75IrN3OSi3-2 — CID 176817212
CID 176817212 (PubChem CID 176817212) has the molecular formula C73H75IrN3OSi3-2 and a molecular weight of 1292.93 g/mol.
| Compound Name | CID 176817212 |
|---|---|
| PubChem CID | 176817212 |
| Molecular Formula | C73H75IrN3OSi3-2 |
| Molecular Weight | 1292.93 g/mol |
| Exact Mass | 1292.52 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc([Si](C)(C)C)cn2)cc1.[2H]C([2H])([2H])c1cccc2nc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)n(-c3c(C(C)C)cc(-c4ccc(-c5cc([Si](C)(C)C)cc([Si](C)(C)C)c5)cc4)cc3C(C)C)c12.[Ir] |
| InChI | InChI=1S/C58H57N2OSi2.C15H18NSi.Ir/c1-35(2)49-31-43(39-24-22-38(23-25-39)42-28-44(62(6,7)8)33-45(29-42)63(9,10)11)32-50(36(3)4)56(49)60-55-37(5)16-14-21-53(55)59-58(60)48-20-15-19-47-52-30-41-27-26-40-17-12-13-18-46(40)51(41)34-54(52)61-57(47)48;1-12-5-7-13(8-6-12)15-10-9-14(11-16-15)17(2,3)4;/h12-19,21-36H,1-11H3;5-7,9-11H,1-4H3;/q2*-1;/i5D3;1D3; |
| InChIKey | IBZALBWTQPADGP-CRFOFUJUSA-N |
| XLogP | 19.08 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1292.93 |
| LogP ≤ 5 | 19.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|