C32H27IrN3O-2 — CID 153485041
5-tert-butyl-2-phenylpyridine;iridium;8-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 153485041) has the molecular formula C32H27IrN3O-2 and a molecular weight of 664.82 g/mol. Its IUPAC name is 5-tert-butyl-2-phenylpyridine;iridium;8-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | 5-tert-butyl-2-phenylpyridine;iridium;8-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 153485041 |
| Molecular Formula | C32H27IrN3O-2 |
| Molecular Weight | 664.82 g/mol |
| Exact Mass | 665.20 |
| IUPAC Name | 5-tert-butyl-2-phenylpyridine;iridium;8-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3ccccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C17H11N2O.C15H16N.Ir/c1-11-8-9-13-12-5-4-6-14(15-7-2-3-10-18-15)16(12)20-17(13)19-11;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h2-5,7-10H,1H3;4-7,9-11H,1-3H3;/q2*-1;/i1D3;; |
| InChIKey | SRMGUCOBRCZEHC-GXXYEPOPSA-N |
| XLogP | 8.00 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.82 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|