C41H31IrN4O — CID 170655079
iridium(3+);bis(2-phenyl-5-(trideuteriomethyl)pyridine);8-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 170655079) has the molecular formula C41H31IrN4O and a molecular weight of 797.00 g/mol. Its IUPAC name is iridium(3+);bis(2-phenyl-5-(trideuteriomethyl)pyridine);8-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | iridium(3+);bis(2-phenyl-5-(trideuteriomethyl)pyridine);8-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 170655079 |
| Molecular Formula | C41H31IrN4O |
| Molecular Weight | 797.00 g/mol |
| Exact Mass | 797.27 |
| IUPAC Name | iridium(3+);bis(2-phenyl-5-(trideuteriomethyl)pyridine);8-pyridin-2-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3ccccn3)[c-]ccc12.[Ir+3] |
| InChI | InChI=1S/C17H11N2O.2C12H10N.Ir/c1-11-8-9-13-12-5-4-6-14(15-7-2-3-10-18-15)16(12)20-17(13)19-11;2*1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-5,7-10H,1H3;2*2-5,7-9H,1H3;/q3*-1;+3/i3*1D3; |
| InChIKey | ZPTWLUALYOQBEB-AFSCPLLHSA-N |
| XLogP | 9.86 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.00 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|