C35H24IrN2O-2 — CID 168730311
iridium;2-[6-(2,3,4,5,6-pentadeuteriophenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 168730311) has the molecular formula C35H24IrN2O-2 and a molecular weight of 688.86 g/mol. Its IUPAC name is iridium;2-[6-(2,3,4,5,6-pentadeuteriophenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | iridium;2-[6-(2,3,4,5,6-pentadeuteriophenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 168730311 |
| Molecular Formula | C35H24IrN2O-2 |
| Molecular Weight | 688.86 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | iridium;2-[6-(2,3,4,5,6-pentadeuteriophenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[2H]c1c([2H])c([2H])c(-c2cccc3c2oc2c(-c4ccccn4)[c-]ccc23)c([2H])c1[2H].[Ir] |
| InChI | InChI=1S/C23H14NO.C12H10N.Ir/c1-2-8-16(9-3-1)17-10-6-11-18-19-12-7-13-20(23(19)25-22(17)18)21-14-4-5-15-24-21;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h1-12,14-15H;2-5,7-9H,1H3;/q2*-1;/i1D,2D,3D,8D,9D;1D3; |
| InChIKey | YLKGQNRGPKRFTJ-XVQNZTTFSA-N |
| XLogP | 8.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.86 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|