C31H21IrN3OS-2 — CID 168828732
iridium;5-methyl-2-phenylpyridine;8-thieno[3,2-b]pyridin-5-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 168828732) has the molecular formula C31H21IrN3OS-2 and a molecular weight of 678.83 g/mol. Its IUPAC name is iridium;5-methyl-2-phenylpyridine;8-thieno[3,2-b]pyridin-5-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | iridium;5-methyl-2-phenylpyridine;8-thieno[3,2-b]pyridin-5-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 168828732 |
| Molecular Formula | C31H21IrN3OS-2 |
| Molecular Weight | 678.83 g/mol |
| Exact Mass | 679.12 |
| IUPAC Name | iridium;5-methyl-2-phenylpyridine;8-thieno[3,2-b]pyridin-5-yl-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3ccc4sccc4n3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C19H11N2OS.C12H10N.Ir/c1-11-5-6-13-12-3-2-4-14(18(12)22-19(13)20-11)15-7-8-17-16(21-15)9-10-23-17;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-3,5-10H,1H3;2-5,7-9H,1H3;/q2*-1;/i1D3;; |
| InChIKey | OYMVGKLTCRECAH-GXXYEPOPSA-N |
| XLogP | 8.22 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.83 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|