C32H21IrN3O-2 — CID 172522979
iridium;2-phenylpyridine;10-pyridin-2-yl-3-(trideuteriomethyl)-9H-[1]benzofuro[3,2-h]isoquinolin-9-ide (PubChem CID 172522979) has the molecular formula C32H21IrN3O-2 and a molecular weight of 658.78 g/mol. Its IUPAC name is iridium;2-phenylpyridine;10-pyridin-2-yl-3-(trideuteriomethyl)-9H-[1]benzofuro[3,2-h]isoquinolin-9-ide.
| Compound Name | iridium;2-phenylpyridine;10-pyridin-2-yl-3-(trideuteriomethyl)-9H-[1]benzofuro[3,2-h]isoquinolin-9-ide |
|---|---|
| PubChem CID | 172522979 |
| Molecular Formula | C32H21IrN3O-2 |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 659.15 |
| IUPAC Name | iridium;2-phenylpyridine;10-pyridin-2-yl-3-(trideuteriomethyl)-9H-[1]benzofuro[3,2-h]isoquinolin-9-ide |
| SMILES | [2H]C([2H])([2H])c1cc2ccc3c4cc[c-]c(-c5ccccn5)c4oc3c2cn1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C21H13N2O.C11H8N.Ir/c1-13-11-14-8-9-16-15-5-4-6-17(19-7-2-3-10-22-19)20(15)24-21(16)18(14)12-23-13;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-5,7-12H,1H3;1-6,8-9H;/q2*-1;/i1D3;; |
| InChIKey | YOPGWCUYJOCHAI-GXXYEPOPSA-N |
| XLogP | 7.85 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|