C28H17FIrN2O-2 — CID 153464747
2-(6-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 153464747) has the molecular formula C28H17FIrN2O-2 and a molecular weight of 608.67 g/mol. Its IUPAC name is 2-(6-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(6-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 153464747 |
| Molecular Formula | C28H17FIrN2O-2 |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | 2-(6-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | Fc1cccc2c1oc1c(-c3ccccn3)[c-]ccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C17H9FNO.C11H8N.Ir/c18-14-8-4-6-12-11-5-3-7-13(16(11)20-17(12)14)15-9-1-2-10-19-15;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-6,8-10H;1-6,8-9H;/q2*-1; |
| InChIKey | PEJGYIUVPWQNJM-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|