C40H35FGeIrN2O-2 — CID 164712552
4-(2-deuteriopropan-2-yl)-2-(6-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)germane (PubChem CID 164712552) has the molecular formula C40H35FGeIrN2O-2 and a molecular weight of 844.56 g/mol. Its IUPAC name is 4-(2-deuteriopropan-2-yl)-2-(6-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)germane.
| Compound Name | 4-(2-deuteriopropan-2-yl)-2-(6-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 164712552 |
| Molecular Formula | C40H35FGeIrN2O-2 |
| Molecular Weight | 844.56 g/mol |
| Exact Mass | 846.16 |
| IUPAC Name | 4-(2-deuteriopropan-2-yl)-2-(6-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1cnc(-c2[c-]cccc2)cc1-c1ccccc1.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2oc2c(F)cccc23)c1.[Ir] |
| InChI | InChI=1S/C20H15FNO.C20H20GeN.Ir/c1-12(2)13-9-10-22-18(11-13)16-7-3-5-14-15-6-4-8-17(21)20(15)23-19(14)16;1-21(2,3)19-15-22-20(17-12-8-5-9-13-17)14-18(19)16-10-6-4-7-11-16;/h3-6,8-12H,1-2H3;4-12,14-15H,1-3H3;/q2*-1;/i12D;; |
| InChIKey | UQWAARNMGJLPME-USJWNWRASA-N |
| XLogP | 10.47 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.56 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|