C40H34GeIrN2O2-2 — CID 166588083
CID 166588083 (PubChem CID 166588083) has the molecular formula C40H34GeIrN2O2-2 and a molecular weight of 840.56 g/mol.
| Compound Name | CID 166588083 |
|---|---|
| PubChem CID | 166588083 |
| Molecular Formula | C40H34GeIrN2O2-2 |
| Molecular Weight | 840.56 g/mol |
| Exact Mass | 842.15 |
| IUPAC Name | — |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2oc2c3ccc3oc4ccccc4c32)c1.[Ir] |
| InChI | InChI=1S/C26H18NO2.C14H16GeN.Ir/c1-15(2)16-12-13-27-21(14-16)19-8-5-7-17-18-10-11-23-24(26(18)29-25(17)19)20-6-3-4-9-22(20)28-23;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h3-7,9-15H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i15D;; |
| InChIKey | SMCQIZADIQLAAL-BSRYWEDOSA-N |
| XLogP | 10.56 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.56 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|