C42H36GeIrN2O-2 — CID 164846151
CID 164846151 (PubChem CID 164846151) has the molecular formula C42H36GeIrN2O-2 and a molecular weight of 850.60 g/mol.
| Compound Name | CID 164846151 |
|---|---|
| PubChem CID | 164846151 |
| Molecular Formula | C42H36GeIrN2O-2 |
| Molecular Weight | 850.60 g/mol |
| Exact Mass | 852.17 |
| IUPAC Name | — |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2oc2c3ccc3ccc4ccccc4c32)c1.[Ir] |
| InChI | InChI=1S/C28H20NO.C14H16GeN.Ir/c1-17(2)20-14-15-29-25(16-20)24-9-5-8-22-23-13-12-19-11-10-18-6-3-4-7-21(18)26(19)28(23)30-27(22)24;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h3-8,10-17H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i17D;; |
| InChIKey | VQQRRIPGTXMTTB-SMYCVDIJSA-N |
| XLogP | 10.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.60 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|