C39H34FGeIrN3O-2 — CID 164712519
8-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]-2-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)germane (PubChem CID 164712519) has the molecular formula C39H34FGeIrN3O-2 and a molecular weight of 845.55 g/mol. Its IUPAC name is 8-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]-2-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)germane.
| Compound Name | 8-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]-2-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 164712519 |
| Molecular Formula | C39H34FGeIrN3O-2 |
| Molecular Weight | 845.55 g/mol |
| Exact Mass | 847.16 |
| IUPAC Name | 8-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]-2-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1cnc(-c2[c-]cccc2)cc1-c1ccccc1.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2oc2nc(F)ccc23)c1.[Ir] |
| InChI | InChI=1S/C20H20GeN.C19H14FN2O.Ir/c1-21(2,3)19-15-22-20(17-12-8-5-9-13-17)14-18(19)16-10-6-4-7-11-16;1-11(2)12-8-9-21-16(10-12)15-5-3-4-13-14-6-7-17(20)22-19(14)23-18(13)15;/h4-12,14-15H,1-3H3;3-4,6-11H,1-2H3;/q2*-1;/i;11D; |
| InChIKey | BBXSUTMGUYHDAH-GFZRUQOSSA-N |
| XLogP | 9.86 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.55 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|