C41H38FGeIrN3O-2 — CID 164713006
2-fluoro-8-[5-phenyl-4-(trideuteriomethyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane (PubChem CID 164713006) has the molecular formula C41H38FGeIrN3O-2 and a molecular weight of 875.62 g/mol. Its IUPAC name is 2-fluoro-8-[5-phenyl-4-(trideuteriomethyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane.
| Compound Name | 2-fluoro-8-[5-phenyl-4-(trideuteriomethyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane |
|---|---|
| PubChem CID | 164713006 |
| Molecular Formula | C41H38FGeIrN3O-2 |
| Molecular Weight | 875.62 g/mol |
| Exact Mass | 877.20 |
| IUPAC Name | 2-fluoro-8-[5-phenyl-4-(trideuteriomethyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[2H]C([2H])([2H])c1cc(-c2[c-]ccc3c2oc2nc(F)ccc23)ncc1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C23H14FN2O.C18H24GeN.Ir/c1-14-12-20(25-13-19(14)15-6-3-2-4-7-15)18-9-5-8-16-17-10-11-21(24)26-23(17)27-22(16)18;1-14(2)11-16-12-18(15-9-7-6-8-10-15)20-13-17(16)19(3,4)5;/h2-8,10-13H,1H3;6-9,12-14H,11H2,1-5H3;/q2*-1;/i1D3;; |
| InChIKey | PTJZQBWPECXCEO-GXXYEPOPSA-N |
| XLogP | 10.25 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.62 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|