C33H30FIrN3OSi-2 — CID 164712500
8-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]-3-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 164712500) has the molecular formula C33H30FIrN3OSi-2 and a molecular weight of 724.93 g/mol. Its IUPAC name is 8-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]-3-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 8-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]-3-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 164712500 |
| Molecular Formula | C33H30FIrN3OSi-2 |
| Molecular Weight | 724.93 g/mol |
| Exact Mass | 725.18 |
| IUPAC Name | 8-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]-3-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2oc2ncc(F)cc23)c1.[Ir] |
| InChI | InChI=1S/C19H14FN2O.C14H16NSi.Ir/c1-11(2)12-6-7-21-17(8-12)15-5-3-4-14-16-9-13(20)10-22-19(16)23-18(14)15;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h3-4,6-11H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i11D;; |
| InChIKey | HJXQJTQZPMEXOQ-IPPMSNHBSA-N |
| XLogP | 8.20 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.93 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|