C46H40IrN2OSi-2 — CID 166575190
4-(2-deuteriopropan-2-yl)-2-[8-(3-phenylphenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 166575190) has the molecular formula C46H40IrN2OSi-2 and a molecular weight of 858.15 g/mol. Its IUPAC name is 4-(2-deuteriopropan-2-yl)-2-[8-(3-phenylphenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-(2-deuteriopropan-2-yl)-2-[8-(3-phenylphenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166575190 |
| Molecular Formula | C46H40IrN2OSi-2 |
| Molecular Weight | 858.15 g/mol |
| Exact Mass | 858.26 |
| IUPAC Name | 4-(2-deuteriopropan-2-yl)-2-[8-(3-phenylphenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2oc2ccc(-c4cccc(-c5ccccc5)c4)cc23)c1.[Ir] |
| InChI | InChI=1S/C32H24NO.C14H16NSi.Ir/c1-21(2)23-16-17-33-30(20-23)28-13-7-12-27-29-19-26(14-15-31(29)34-32(27)28)25-11-6-10-24(18-25)22-8-4-3-5-9-22;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h3-12,14-21H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i21D;; |
| InChIKey | HSLJQJYUPJYIHN-LZNRWZRQSA-N |
| XLogP | 12.00 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.15 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|