C46H38IrNOSi — CID 162708820
4-[3-[1-deuterio-1-(4-phenylphenyl)ethyl]benzene-6-id-1-yl]-3H-dibenzofuran-3-ide;iridium(3+);trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 162708820) has the molecular formula C46H38IrNOSi and a molecular weight of 842.13 g/mol. Its IUPAC name is 4-[3-[1-deuterio-1-(4-phenylphenyl)ethyl]benzene-6-id-1-yl]-3H-dibenzofuran-3-ide;iridium(3+);trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-[3-[1-deuterio-1-(4-phenylphenyl)ethyl]benzene-6-id-1-yl]-3H-dibenzofuran-3-ide;iridium(3+);trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 162708820 |
| Molecular Formula | C46H38IrNOSi |
| Molecular Weight | 842.13 g/mol |
| Exact Mass | 842.24 |
| IUPAC Name | 4-[3-[1-deuterio-1-(4-phenylphenyl)ethyl]benzene-6-id-1-yl]-3H-dibenzofuran-3-ide;iridium(3+);trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(c1ccc(-c2ccccc2)cc1)c1cc[c-]c(-c2[c-]ccc3c2oc2ccccc23)c1.[Ir+3] |
| InChI | InChI=1S/C32H22O.C14H16NSi.Ir/c1-22(23-17-19-25(20-18-23)24-9-3-2-4-10-24)26-11-7-12-27(21-26)28-14-8-15-30-29-13-5-6-16-31(29)33-32(28)30;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h2-11,13,15-22H,1H3;4-7,9-11H,1-3H3;/q-2;-1;+3/i22D;; |
| InChIKey | SUXGHTPMCKYYLB-HNPGGMQSSA-N |
| XLogP | 11.76 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.13 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|