C34H31FIrNSi — CID 162708090
1-(1-deuterio-1-phenylethyl)-3-phenylbenzene-4-ide;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium(3+) (PubChem CID 162708090) has the molecular formula C34H31FIrNSi and a molecular weight of 693.94 g/mol. Its IUPAC name is 1-(1-deuterio-1-phenylethyl)-3-phenylbenzene-4-ide;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium(3+).
| Compound Name | 1-(1-deuterio-1-phenylethyl)-3-phenylbenzene-4-ide;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium(3+) |
|---|---|
| PubChem CID | 162708090 |
| Molecular Formula | C34H31FIrNSi |
| Molecular Weight | 693.94 g/mol |
| Exact Mass | 694.19 |
| IUPAC Name | 1-(1-deuterio-1-phenylethyl)-3-phenylbenzene-4-ide;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium(3+) |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cc(F)cc2)nc1.[2H]C(C)(c1ccccc1)c1cc[c-]c(-c2[c-]cccc2)c1.[Ir+3] |
| InChI | InChI=1S/C20H16.C14H15FNSi.Ir/c1-16(17-9-4-2-5-10-17)19-13-8-14-20(15-19)18-11-6-3-7-12-18;1-17(2,3)13-8-9-14(16-10-13)11-4-6-12(15)7-5-11;/h2-11,13,15-16H,1H3;4,6-10H,1-3H3;/q-2;-1;+3/i16D;; |
| InChIKey | UZPJYSQQEYOWAE-DGSKOHBNSA-N |
| XLogP | 8.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.94 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|