C33H30IrN2-2 — CID 162710417
2-[4-(1-deuterio-1-phenylethyl)benzene-6-id-1-yl]pyridine;4-(2-deuteriopropan-2-yl)-2-phenylpyridine;iridium (PubChem CID 162710417) has the molecular formula C33H30IrN2-2 and a molecular weight of 648.85 g/mol. Its IUPAC name is 2-[4-(1-deuterio-1-phenylethyl)benzene-6-id-1-yl]pyridine;4-(2-deuteriopropan-2-yl)-2-phenylpyridine;iridium.
| Compound Name | 2-[4-(1-deuterio-1-phenylethyl)benzene-6-id-1-yl]pyridine;4-(2-deuteriopropan-2-yl)-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 162710417 |
| Molecular Formula | C33H30IrN2-2 |
| Molecular Weight | 648.85 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | 2-[4-(1-deuterio-1-phenylethyl)benzene-6-id-1-yl]pyridine;4-(2-deuteriopropan-2-yl)-2-phenylpyridine;iridium |
| SMILES | [2H]C(C)(C)c1ccnc(-c2[c-]cccc2)c1.[2H]C(C)(c1c[c-]c(-c2ccccn2)cc1)c1ccccc1.[Ir] |
| InChI | InChI=1S/C19H16N.C14H14N.Ir/c1-15(16-7-3-2-4-8-16)17-10-12-18(13-11-17)19-9-5-6-14-20-19;1-11(2)13-8-9-15-14(10-13)12-6-4-3-5-7-12;/h2-12,14-15H,1H3;3-6,8-11H,1-2H3;/q2*-1;/i15D;11D; |
| InChIKey | HPUTXYCRAZHQKN-XIWWXLMKSA-N |
| XLogP | 8.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.85 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|