C37H34IrN2-2 — CID 164792210
iridium;2-(9-methyl-10-propan-2-yl-3H-phenanthren-3-id-2-yl)-4-propan-2-ylpyridine;2-phenylpyridine (PubChem CID 164792210) has the molecular formula C37H34IrN2-2 and a molecular weight of 698.91 g/mol. Its IUPAC name is iridium;2-(9-methyl-10-propan-2-yl-3H-phenanthren-3-id-2-yl)-4-propan-2-ylpyridine;2-phenylpyridine.
| Compound Name | iridium;2-(9-methyl-10-propan-2-yl-3H-phenanthren-3-id-2-yl)-4-propan-2-ylpyridine;2-phenylpyridine |
|---|---|
| PubChem CID | 164792210 |
| Molecular Formula | C37H34IrN2-2 |
| Molecular Weight | 698.91 g/mol |
| Exact Mass | 699.24 |
| IUPAC Name | iridium;2-(9-methyl-10-propan-2-yl-3H-phenanthren-3-id-2-yl)-4-propan-2-ylpyridine;2-phenylpyridine |
| SMILES | Cc1c(C(C)C)c2cc(-c3cc(C(C)C)ccn3)[c-]cc2c2ccccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H26N.C11H8N.Ir/c1-16(2)19-12-13-27-25(15-19)20-10-11-23-22-9-7-6-8-21(22)18(5)26(17(3)4)24(23)14-20;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h6-9,11-17H,1-5H3;1-6,8-9H;/q2*-1; |
| InChIKey | BIDHKKVCXPGTOA-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.91 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|