C35H30IrN2-2 — CID 164792174
2-[9,10-bis(trideuteriomethyl)-3H-phenanthren-3-id-2-yl]-4-(2-deuteriopropan-2-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 164792174) has the molecular formula C35H30IrN2-2 and a molecular weight of 677.90 g/mol. Its IUPAC name is 2-[9,10-bis(trideuteriomethyl)-3H-phenanthren-3-id-2-yl]-4-(2-deuteriopropan-2-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-[9,10-bis(trideuteriomethyl)-3H-phenanthren-3-id-2-yl]-4-(2-deuteriopropan-2-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 164792174 |
| Molecular Formula | C35H30IrN2-2 |
| Molecular Weight | 677.90 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | 2-[9,10-bis(trideuteriomethyl)-3H-phenanthren-3-id-2-yl]-4-(2-deuteriopropan-2-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | [2H]C([2H])([2H])c1c(C([2H])([2H])[2H])c2ccccc2c2c[c-]c(-c3cc(C([2H])(C)C)ccn3)cc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C24H22N.C11H8N.Ir/c1-15(2)18-11-12-25-24(14-18)19-9-10-22-21-8-6-5-7-20(21)16(3)17(4)23(22)13-19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-8,10-15H,1-4H3;1-6,8-9H;/q2*-1;/i3D3,4D3,15D;; |
| InChIKey | BQBLKYXGDDOJLW-ZPWRRBSZSA-N |
| XLogP | 9.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.90 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|