C24H23N — CID 164792192
2-[9,10-bis(trideuteriomethyl)phenanthren-2-yl]-4-propan-2-ylpyridine (PubChem CID 164792192) has the molecular formula C24H23N and a molecular weight of 331.49 g/mol. Its IUPAC name is 2-[9,10-bis(trideuteriomethyl)phenanthren-2-yl]-4-propan-2-ylpyridine.
| Compound Name | 2-[9,10-bis(trideuteriomethyl)phenanthren-2-yl]-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 164792192 |
| Molecular Formula | C24H23N |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | 2-[9,10-bis(trideuteriomethyl)phenanthren-2-yl]-4-propan-2-ylpyridine |
| SMILES | [2H]C([2H])([2H])c1c(C([2H])([2H])[2H])c2cc(-c3cc(C(C)C)ccn3)ccc2c2ccccc12 |
| InChI | InChI=1S/C24H23N/c1-15(2)18-11-12-25-24(14-18)19-9-10-22-21-8-6-5-7-20(21)16(3)17(4)23(22)13-19/h5-15H,1-4H3/i3D3,4D3 |
| InChIKey | PNALDKWYRZCNJM-LIJFRPJRSA-N |
| XLogP | 6.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|