C26H21NS — CID 166576650
2-(9-phenyldibenzothiophen-3-yl)-4-propan-2-ylpyridine (PubChem CID 166576650) has the molecular formula C26H21NS and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-(9-phenyldibenzothiophen-3-yl)-4-propan-2-ylpyridine.
| Compound Name | 2-(9-phenyldibenzothiophen-3-yl)-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 166576650 |
| Molecular Formula | C26H21NS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-(9-phenyldibenzothiophen-3-yl)-4-propan-2-ylpyridine |
| SMILES | CC(C)c1ccnc(-c2ccc3c(c2)sc2cccc(-c4ccccc4)c23)c1 |
| InChI | InChI=1S/C26H21NS/c1-17(2)19-13-14-27-23(15-19)20-11-12-22-25(16-20)28-24-10-6-9-21(26(22)24)18-7-4-3-5-8-18/h3-17H,1-2H3 |
| InChIKey | DLXRDCVYFATBMS-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |