C46H40GeIrN2S-2 — CID 166574198
iridium;2-(9-phenyl-3H-dibenzothiophen-3-id-2-yl)-4-propan-2-ylpyridine;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane (PubChem CID 166574198) has the molecular formula C46H40GeIrN2S-2 and a molecular weight of 917.73 g/mol. Its IUPAC name is iridium;2-(9-phenyl-3H-dibenzothiophen-3-id-2-yl)-4-propan-2-ylpyridine;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane.
| Compound Name | iridium;2-(9-phenyl-3H-dibenzothiophen-3-id-2-yl)-4-propan-2-ylpyridine;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane |
|---|---|
| PubChem CID | 166574198 |
| Molecular Formula | C46H40GeIrN2S-2 |
| Molecular Weight | 917.73 g/mol |
| Exact Mass | 919.18 |
| IUPAC Name | iridium;2-(9-phenyl-3H-dibenzothiophen-3-id-2-yl)-4-propan-2-ylpyridine;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane |
| SMILES | CC(C)c1ccnc(-c2[c-]cc3sc4cccc(-c5ccccc5)c4c3c2)c1.C[Ge](C)(C)c1ccc(-c2[c-]ccc(-c3ccccc3)c2)nc1.[Ir] |
| InChI | InChI=1S/C26H20NS.C20H20GeN.Ir/c1-17(2)19-13-14-27-23(16-19)20-11-12-24-22(15-20)26-21(9-6-10-25(26)28-24)18-7-4-3-5-8-18;1-21(2,3)19-12-13-20(22-15-19)18-11-7-10-17(14-18)16-8-5-4-6-9-16;/h3-10,12-17H,1-2H3;4-10,12-15H,1-3H3;/q2*-1; |
| InChIKey | DXBQOIYFFJKVAW-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.73 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|