C41H38GeIrN2S-2 — CID 166577225
4-tert-butyl-2-(9-phenyl-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 166577225) has the molecular formula C41H38GeIrN2S-2 and a molecular weight of 855.66 g/mol. Its IUPAC name is 4-tert-butyl-2-(9-phenyl-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 4-tert-butyl-2-(9-phenyl-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166577225 |
| Molecular Formula | C41H38GeIrN2S-2 |
| Molecular Weight | 855.66 g/mol |
| Exact Mass | 857.16 |
| IUPAC Name | 4-tert-butyl-2-(9-phenyl-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cc3sc4cccc(-c5ccccc5)c4c3c2)c1.C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C27H22NS.C14H16GeN.Ir/c1-27(2,3)20-14-15-28-23(17-20)19-12-13-24-22(16-19)26-21(10-7-11-25(26)29-24)18-8-5-4-6-9-18;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h4-11,13-17H,1-3H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | KOYSJZOJRSWTAE-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.66 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|