C37H35FGeIrN2S-2 — CID 164712443
4-(cyclopentylmethyl)-2-(9-fluoro-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 164712443) has the molecular formula C37H35FGeIrN2S-2 and a molecular weight of 823.59 g/mol. Its IUPAC name is 4-(cyclopentylmethyl)-2-(9-fluoro-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 4-(cyclopentylmethyl)-2-(9-fluoro-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 164712443 |
| Molecular Formula | C37H35FGeIrN2S-2 |
| Molecular Weight | 823.59 g/mol |
| Exact Mass | 825.14 |
| IUPAC Name | 4-(cyclopentylmethyl)-2-(9-fluoro-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.Fc1cccc2sc3c[c-]c(-c4cc(CC5CCCC5)ccn4)cc3c12.[Ir] |
| InChI | InChI=1S/C23H19FNS.C14H16GeN.Ir/c24-19-6-3-7-22-23(19)18-14-17(8-9-21(18)26-22)20-13-16(10-11-25-20)12-15-4-1-2-5-15;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h3,6-7,9-11,13-15H,1-2,4-5,12H2;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | CYQIGYLIIPOYCB-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.59 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|