C47H37IrN3S-2 — CID 168766274
CID 168766274 (PubChem CID 168766274) has the molecular formula C47H37IrN3S-2 and a molecular weight of 868.12 g/mol.
| Compound Name | CID 168766274 |
|---|---|
| PubChem CID | 168766274 |
| Molecular Formula | C47H37IrN3S-2 |
| Molecular Weight | 868.12 g/mol |
| Exact Mass | 868.23 |
| IUPAC Name | — |
| SMILES | Cc1c2cccc1-c1c(ccc3sc4ccccc4c13)Nc1c[c-]c(-c3cc(CC4CCCC4)ccn3)cc1-2.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C36H29N2S.C11H8N.Ir/c1-22-26-10-6-11-27(22)35-31(15-16-34-36(35)28-9-4-5-12-33(28)39-34)38-30-14-13-25(21-29(26)30)32-20-24(17-18-37-32)19-23-7-2-3-8-23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-6,9-12,14-18,20-21,23,38H,2-3,7-8,19H2,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | GYPYDMFRPLXAOV-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.12 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|