C46H37IrN3O-2 — CID 168766259
CID 168766259 (PubChem CID 168766259) has the molecular formula C46H37IrN3O-2 and a molecular weight of 840.04 g/mol.
| Compound Name | CID 168766259 |
|---|---|
| PubChem CID | 168766259 |
| Molecular Formula | C46H37IrN3O-2 |
| Molecular Weight | 840.04 g/mol |
| Exact Mass | 840.26 |
| IUPAC Name | — |
| SMILES | Cc1c2cccc1-c1c(ccc3oc4ccccc4c13)Nc1c[c-]c(-c3cc(CC(C)(C)C)ccn3)cc1-2.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C35H29N2O.C11H8N.Ir/c1-21-24-9-7-10-25(21)33-29(14-15-32-34(33)26-8-5-6-11-31(26)38-32)37-28-13-12-23(19-27(24)28)30-18-22(16-17-36-30)20-35(2,3)4;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-11,13-19,37H,20H2,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | QNPQYBPVSJMVFI-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.04 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|