C42H29IrN3O-2 — CID 168766304
CID 168766304 (PubChem CID 168766304) has the molecular formula C42H29IrN3O-2 and a molecular weight of 786.95 g/mol.
| Compound Name | CID 168766304 |
|---|---|
| PubChem CID | 168766304 |
| Molecular Formula | C42H29IrN3O-2 |
| Molecular Weight | 786.95 g/mol |
| Exact Mass | 787.21 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2[c-]cc3c(c2)-c2cccc(c2C)-c2ccc4c(oc5ccccc54)c2N3)nc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C31H21N2O.C11H8N.Ir/c1-18-10-14-27(32-17-18)20-11-15-28-26(16-20)22-8-5-7-21(19(22)2)24-12-13-25-23-6-3-4-9-29(23)34-31(25)30(24)33-28;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-10,12-17,33H,1-2H3;1-6,8-9H;/q2*-1;/i1D3;; |
| InChIKey | NBIZFTJWLPSYBC-GXXYEPOPSA-N |
| XLogP | 11.00 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.95 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|