C40H28IrN2O-2 — CID 172506804
iridium;5-methyl-2-(3-naphtho[2,1-b][1]benzofuran-4-ylbenzene-6-id-1-yl)pyridine;2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 172506804) has the molecular formula C40H28IrN2O-2 and a molecular weight of 747.91 g/mol. Its IUPAC name is iridium;5-methyl-2-(3-naphtho[2,1-b][1]benzofuran-4-ylbenzene-6-id-1-yl)pyridine;2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | iridium;5-methyl-2-(3-naphtho[2,1-b][1]benzofuran-4-ylbenzene-6-id-1-yl)pyridine;2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 172506804 |
| Molecular Formula | C40H28IrN2O-2 |
| Molecular Weight | 747.91 g/mol |
| Exact Mass | 748.20 |
| IUPAC Name | iridium;5-methyl-2-(3-naphtho[2,1-b][1]benzofuran-4-ylbenzene-6-id-1-yl)pyridine;2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | Cc1ccc(-c2[c-]ccc(-c3cccc4c3ccc3oc5ccccc5c34)c2)nc1.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C28H18NO.C12H10N.Ir/c1-18-12-14-25(29-17-18)20-7-4-6-19(16-20)21-9-5-10-23-22(21)13-15-27-28(23)24-8-2-3-11-26(24)30-27;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-6,8-17H,1H3;2-5,7-9H,1H3;/q2*-1;/i;1D3; |
| InChIKey | SUSOBTNLZCWBTF-ICMJTWPQSA-N |
| XLogP | 10.43 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.91 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|