C33H30IrN2OSi-2 — CID 155619246
iridium;5-(trideuteriomethyl)-2-[4-(trideuteriomethyl)benzene-6-id-1-yl]pyridine;trimethyl-(1-phenyl-[1]benzofuro[3,2-c]pyridin-4-yl)silane (PubChem CID 155619246) has the molecular formula C33H30IrN2OSi-2 and a molecular weight of 696.96 g/mol. Its IUPAC name is iridium;5-(trideuteriomethyl)-2-[4-(trideuteriomethyl)benzene-6-id-1-yl]pyridine;trimethyl-(1-phenyl-[1]benzofuro[3,2-c]pyridin-4-yl)silane.
| Compound Name | iridium;5-(trideuteriomethyl)-2-[4-(trideuteriomethyl)benzene-6-id-1-yl]pyridine;trimethyl-(1-phenyl-[1]benzofuro[3,2-c]pyridin-4-yl)silane |
|---|---|
| PubChem CID | 155619246 |
| Molecular Formula | C33H30IrN2OSi-2 |
| Molecular Weight | 696.96 g/mol |
| Exact Mass | 697.21 |
| IUPAC Name | iridium;5-(trideuteriomethyl)-2-[4-(trideuteriomethyl)benzene-6-id-1-yl]pyridine;trimethyl-(1-phenyl-[1]benzofuro[3,2-c]pyridin-4-yl)silane |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)c2c1oc1ccccc12.[2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[Ir] |
| InChI | InChI=1S/C20H18NOSi.C13H12N.Ir/c1-23(2,3)17-13-21-19(14-9-5-4-6-10-14)18-15-11-7-8-12-16(15)22-20(17)18;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h4-9,11-13H,1-3H3;3-6,8-9H,1-2H3;/q2*-1;/i;1D3,2D3; |
| InChIKey | FDSLCBLFTDCEJK-RUHQGNAASA-N |
| XLogP | 8.16 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.96 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|