C32H29IrN3OSi-2 — CID 164796943
iridium;5-methyl-2-phenylpyridine;trimethyl-[6-[5-(trideuteriomethyl)-2-pyridinyl]-7H-[1]benzofuro[3,2-b]pyridin-7-id-9-yl]silane (PubChem CID 164796943) has the molecular formula C32H29IrN3OSi-2 and a molecular weight of 694.93 g/mol. Its IUPAC name is iridium;5-methyl-2-phenylpyridine;trimethyl-[6-[5-(trideuteriomethyl)-2-pyridinyl]-7H-[1]benzofuro[3,2-b]pyridin-7-id-9-yl]silane.
| Compound Name | iridium;5-methyl-2-phenylpyridine;trimethyl-[6-[5-(trideuteriomethyl)-2-pyridinyl]-7H-[1]benzofuro[3,2-b]pyridin-7-id-9-yl]silane |
|---|---|
| PubChem CID | 164796943 |
| Molecular Formula | C32H29IrN3OSi-2 |
| Molecular Weight | 694.93 g/mol |
| Exact Mass | 695.19 |
| IUPAC Name | iridium;5-methyl-2-phenylpyridine;trimethyl-[6-[5-(trideuteriomethyl)-2-pyridinyl]-7H-[1]benzofuro[3,2-b]pyridin-7-id-9-yl]silane |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc(-c2[c-]cc([Si](C)(C)C)c3c2oc2cccnc23)nc1.[Ir] |
| InChI | InChI=1S/C20H19N2OSi.C12H10N.Ir/c1-13-7-9-15(22-12-13)14-8-10-17(24(2,3)4)18-19-16(23-20(14)18)6-5-11-21-19;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-7,9-12H,1-4H3;2-5,7-9H,1H3;/q2*-1;/i1D3;; |
| InChIKey | XBJXDWGQXYEWPP-GXXYEPOPSA-N |
| XLogP | 7.55 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.93 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|