C33H30IrN2SSi-2 — CID 155608272
iridium;5-methyl-2-phenylpyridine;trimethyl-[4-[5-(trideuteriomethyl)-2-pyridinyl]-3H-dibenzothiophen-3-id-1-yl]silane (PubChem CID 155608272) has the molecular formula C33H30IrN2SSi-2 and a molecular weight of 710.01 g/mol. Its IUPAC name is iridium;5-methyl-2-phenylpyridine;trimethyl-[4-[5-(trideuteriomethyl)-2-pyridinyl]-3H-dibenzothiophen-3-id-1-yl]silane.
| Compound Name | iridium;5-methyl-2-phenylpyridine;trimethyl-[4-[5-(trideuteriomethyl)-2-pyridinyl]-3H-dibenzothiophen-3-id-1-yl]silane |
|---|---|
| PubChem CID | 155608272 |
| Molecular Formula | C33H30IrN2SSi-2 |
| Molecular Weight | 710.01 g/mol |
| Exact Mass | 710.17 |
| IUPAC Name | iridium;5-methyl-2-phenylpyridine;trimethyl-[4-[5-(trideuteriomethyl)-2-pyridinyl]-3H-dibenzothiophen-3-id-1-yl]silane |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc(-c2[c-]cc([Si](C)(C)C)c3c2sc2ccccc23)nc1.[Ir] |
| InChI | InChI=1S/C21H20NSSi.C12H10N.Ir/c1-14-9-11-17(22-13-14)15-10-12-19(24(2,3)4)20-16-7-5-6-8-18(16)23-21(15)20;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-9,11-13H,1-4H3;2-5,7-9H,1H3;/q2*-1;/i1D3;; |
| InChIKey | BXMSNXGBMQJFES-GXXYEPOPSA-N |
| XLogP | 8.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.01 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|