C13H12IrN- — CID 167377374
iridium;5-(trideuteriomethyl)-2-[4-(trideuteriomethyl)benzene-6-id-1-yl]pyridine (PubChem CID 167377374) has the molecular formula C13H12IrN- and a molecular weight of 380.50 g/mol. Its IUPAC name is iridium;5-(trideuteriomethyl)-2-[4-(trideuteriomethyl)benzene-6-id-1-yl]pyridine.
| Compound Name | iridium;5-(trideuteriomethyl)-2-[4-(trideuteriomethyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 167377374 |
| Molecular Formula | C13H12IrN- |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | iridium;5-(trideuteriomethyl)-2-[4-(trideuteriomethyl)benzene-6-id-1-yl]pyridine |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[Ir] |
| InChI | InChI=1S/C13H12N.Ir/c1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h3-6,8-9H,1-2H3;/q-1;/i1D3,2D3; |
| InChIKey | OIGGQRLHUQXVMN-TXHXQZCNSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|