C34H26IrN2O-2 — CID 162777501
CID 162777501 (PubChem CID 162777501) has the molecular formula C34H26IrN2O-2 and a molecular weight of 682.89 g/mol.
| Compound Name | CID 162777501 |
|---|---|
| PubChem CID | 162777501 |
| Molecular Formula | C34H26IrN2O-2 |
| Molecular Weight | 682.89 g/mol |
| Exact Mass | 683.24 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]cc3oc4cccc5ccc2c3c54)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C21H14NO.C13H12N.Ir/c1-12-10-17(22-11-13(12)2)15-8-9-19-21-16(15)7-6-14-4-3-5-18(23-19)20(14)21;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h3-7,9-11H,1-2H3;3-6,8-9H,1-2H3;/q2*-1;/i2*1D3,2D3; |
| InChIKey | JMLYWCSAHPMAQN-RKTRJPORSA-N |
| XLogP | 8.82 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.89 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|