C41H40IrN2O-2 — CID 162777281
CID 162777281 (PubChem CID 162777281) has the molecular formula C41H40IrN2O-2 and a molecular weight of 776.04 g/mol.
| Compound Name | CID 162777281 |
|---|---|
| PubChem CID | 162777281 |
| Molecular Formula | C41H40IrN2O-2 |
| Molecular Weight | 776.04 g/mol |
| Exact Mass | 776.32 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])C(C)(C)C)cn2)cc1.[2H]C([2H])(c1ccnc(-c2[c-]cc3oc4cccc5ccc2c3c54)c1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C24H20NO.C17H20N.Ir/c1-24(2,3)14-15-11-12-25-19(13-15)17-9-10-21-23-18(17)8-7-16-5-4-6-20(26-21)22(16)23;1-13-5-8-15(9-6-13)16-10-7-14(12-18-16)11-17(2,3)4;/h4-8,10-13H,14H2,1-3H3;5-8,10,12H,11H2,1-4H3;/q2*-1;/i14D2;1D3,11D2; |
| InChIKey | JSAQLKUGHAOTOJ-VAIIKDJFSA-N |
| XLogP | 11.07 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.04 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|