C40H34IrN2OS-2 — CID 162777263
CID 162777263 (PubChem CID 162777263) has the molecular formula C40H34IrN2OS-2 and a molecular weight of 794.08 g/mol.
| Compound Name | CID 162777263 |
|---|---|
| PubChem CID | 162777263 |
| Molecular Formula | C40H34IrN2OS-2 |
| Molecular Weight | 794.08 g/mol |
| Exact Mass | 794.27 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])C(C)(C)C)cn2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]cc3sc4cc5ccccc5c5oc2c3c45)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C23H14NOS.C17H20N.Ir/c1-12-9-17(24-11-13(12)2)16-7-8-18-20-21-19(26-18)10-14-5-3-4-6-15(14)22(21)25-23(16)20;1-13-5-8-15(9-6-13)16-10-7-14(12-18-16)11-17(2,3)4;/h3-6,8-11H,1-2H3;5-8,10,12H,11H2,1-4H3;/q2*-1;/i1D3,2D3;1D3,11D2; |
| InChIKey | JZQLNYDJBPLJFN-QWSVJUNDSA-N |
| XLogP | 11.31 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.08 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|