C50H42IrN2O-2 — CID 166044009
CID 166044009 (PubChem CID 166044009) has the molecular formula C50H42IrN2O-2 and a molecular weight of 889.18 g/mol.
| Compound Name | CID 166044009 |
|---|---|
| PubChem CID | 166044009 |
| Molecular Formula | C50H42IrN2O-2 |
| Molecular Weight | 889.18 g/mol |
| Exact Mass | 889.36 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cc(C([2H])([2H])C(C)(C)C)ccc1-c1ccnc(-c2[c-]ccc3c2oc2c3ccc3ccc4ccccc4c32)c1.[2H]C([2H])c1ccc(-c2[c-]cc(C([2H])([2H])[2H])cc2)nc1.[Ir] |
| InChI | InChI=1S/C37H30NO.C13H12N.Ir/c1-23-20-24(22-37(2,3)4)12-16-28(23)27-18-19-38-33(21-27)32-11-7-10-30-31-17-15-26-14-13-25-8-5-6-9-29(25)34(26)36(31)39-35(30)32;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h5-10,12-21H,22H2,1-4H3;3-6,8-9H,1-2H3;/q2*-1;/i1D3,22D2;1D3,2D2; |
| InChIKey | YQQNZLOSNHUEDO-XGFNLXBWSA-N |
| XLogP | 13.48 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.18 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|