C53H42IrN2O-2 — CID 166044002
CID 166044002 (PubChem CID 166044002) has the molecular formula C53H42IrN2O-2 and a molecular weight of 922.19 g/mol.
| Compound Name | CID 166044002 |
|---|---|
| PubChem CID | 166044002 |
| Molecular Formula | C53H42IrN2O-2 |
| Molecular Weight | 922.19 g/mol |
| Exact Mass | 922.34 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccc(-c2ccnc(-c3[c-]ccc4c3oc3cc5c6ccccc6c6ccccc6c5cc34)c2)cc1)C(C)(C)C.[2H]C([2H])c1ccc(-c2[c-]cc(C([2H])([2H])[2H])cc2)nc1.[Ir] |
| InChI | InChI=1S/C40H30NO.C13H12N.Ir/c1-40(2,3)24-25-15-17-26(18-16-25)27-19-20-41-37(21-27)33-14-8-13-32-36-22-34-30-11-6-4-9-28(30)29-10-5-7-12-31(29)35(34)23-38(36)42-39(32)33;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h4-13,15-23H,24H2,1-3H3;3-6,8-9H,1-2H3;/q2*-1;/i24D2;1D3,2D2; |
| InChIKey | UINBEOGTBGTDGI-UUMBIMJSSA-N |
| XLogP | 14.33 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.19 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|