C45H36IrN2O2Si-2 — CID 166044115
CID 166044115 (PubChem CID 166044115) has the molecular formula C45H36IrN2O2Si-2 and a molecular weight of 863.13 g/mol.
| Compound Name | CID 166044115 |
|---|---|
| PubChem CID | 166044115 |
| Molecular Formula | C45H36IrN2O2Si-2 |
| Molecular Weight | 863.13 g/mol |
| Exact Mass | 863.26 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2ccnc(-c3[c-]ccc4c3oc3c4ccc4c5ccccc5oc43)c2)cc1.[2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[Ir] |
| InChI | InChI=1S/C32H24NO2Si.C13H12N.Ir/c1-36(2,3)22-13-11-20(12-14-22)21-17-18-33-28(19-21)27-9-6-8-24-26-16-15-25-23-7-4-5-10-29(23)34-31(25)32(26)35-30(24)27;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h4-8,10-19H,1-3H3;3-6,8-9H,1-2H3;/q2*-1;/i;1D3,2D3; |
| InChIKey | MUOGSRAGXBFCPT-RUHQGNAASA-N |
| XLogP | 11.72 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.13 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|