C39H38IrN2OS-2 — CID 162777290
CID 162777290 (PubChem CID 162777290) has the molecular formula C39H38IrN2OS-2 and a molecular weight of 782.07 g/mol.
| Compound Name | CID 162777290 |
|---|---|
| PubChem CID | 162777290 |
| Molecular Formula | C39H38IrN2OS-2 |
| Molecular Weight | 782.07 g/mol |
| Exact Mass | 782.28 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])C(C)(C)C)cn2)cc1.[2H]C([2H])(c1ccnc(-c2[c-]cc3oc4cccc5sc2c3c45)c1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C22H18NOS.C17H20N.Ir/c1-22(2,3)12-13-9-10-23-15(11-13)14-7-8-17-20-19-16(24-17)5-4-6-18(19)25-21(14)20;1-13-5-8-15(9-6-13)16-10-7-14(12-18-16)11-17(2,3)4;/h4-6,8-11H,12H2,1-3H3;5-8,10,12H,11H2,1-4H3;/q2*-1;/i12D2;1D3,11D2; |
| InChIKey | XVWRAJHPFDKAKQ-QCMJXTMTSA-N |
| XLogP | 11.13 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.07 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|