C44H40F2GeIrN2S-2 — CID 166577959
4-(cyclohexylmethyl)-2-[7-(2,5-difluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 166577959) has the molecular formula C44H40F2GeIrN2S-2 and a molecular weight of 931.71 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-2-[7-(2,5-difluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 4-(cyclohexylmethyl)-2-[7-(2,5-difluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166577959 |
| Molecular Formula | C44H40F2GeIrN2S-2 |
| Molecular Weight | 931.71 g/mol |
| Exact Mass | 933.17 |
| IUPAC Name | 4-(cyclohexylmethyl)-2-[7-(2,5-difluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.Fc1ccc(F)c(-c2ccc3c(c2)sc2c(-c4cc(CC5CCCCC5)ccn4)[c-]ccc23)c1.[Ir] |
| InChI | InChI=1S/C30H24F2NS.C14H16GeN.Ir/c31-22-10-12-27(32)26(18-22)21-9-11-23-24-7-4-8-25(30(24)34-29(23)17-21)28-16-20(13-14-33-28)15-19-5-2-1-3-6-19;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h4,7,9-14,16-19H,1-3,5-6,15H2;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | ZLMHYOVKFBCKRF-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.71 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|