C47H47FIrN2SSi-2 — CID 166576006
4-(cyclohexylmethyl)-2-[8-(3-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane (PubChem CID 166576006) has the molecular formula C47H47FIrN2SSi-2 and a molecular weight of 911.27 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-2-[8-(3-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane.
| Compound Name | 4-(cyclohexylmethyl)-2-[8-(3-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166576006 |
| Molecular Formula | C47H47FIrN2SSi-2 |
| Molecular Weight | 911.27 g/mol |
| Exact Mass | 911.29 |
| IUPAC Name | 4-(cyclohexylmethyl)-2-[8-(3-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Fc1cccc(-c2ccc3sc4c(-c5cc(CC6CCCCC6)ccn5)[c-]ccc4c3c2)c1.[Ir] |
| InChI | InChI=1S/C30H25FNS.C17H22NSi.Ir/c31-24-9-4-8-22(18-24)23-12-13-29-27(19-23)25-10-5-11-26(30(25)33-29)28-17-21(14-15-32-28)16-20-6-2-1-3-7-20;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h4-5,8-10,12-15,17-20H,1-3,6-7,16H2;6-9,11-13H,1-5H3;/q2*-1; |
| InChIKey | AQEQOQCKAVAING-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.27 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|