C43H40GeIrN2-2 — CID 164792269
4-(2-deuteriopropan-2-yl)-2-(3H-phenanthren-3-id-2-yl)pyridine;iridium;trimethyl-[6-(4-methyl-3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane (PubChem CID 164792269) has the molecular formula C43H40GeIrN2-2 and a molecular weight of 850.64 g/mol. Its IUPAC name is 4-(2-deuteriopropan-2-yl)-2-(3H-phenanthren-3-id-2-yl)pyridine;iridium;trimethyl-[6-(4-methyl-3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane.
| Compound Name | 4-(2-deuteriopropan-2-yl)-2-(3H-phenanthren-3-id-2-yl)pyridine;iridium;trimethyl-[6-(4-methyl-3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane |
|---|---|
| PubChem CID | 164792269 |
| Molecular Formula | C43H40GeIrN2-2 |
| Molecular Weight | 850.64 g/mol |
| Exact Mass | 852.21 |
| IUPAC Name | 4-(2-deuteriopropan-2-yl)-2-(3H-phenanthren-3-id-2-yl)pyridine;iridium;trimethyl-[6-(4-methyl-3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane |
| SMILES | Cc1c[c-]c(-c2ccc([Ge](C)(C)C)cn2)cc1-c1ccccc1.[2H]C(C)(C)c1ccnc(-c2[c-]cc3c(ccc4ccccc43)c2)c1.[Ir] |
| InChI | InChI=1S/C22H18N.C21H22GeN.Ir/c1-15(2)17-11-12-23-22(14-17)19-9-10-21-18(13-19)8-7-16-5-3-4-6-20(16)21;1-16-10-11-18(14-20(16)17-8-6-5-7-9-17)21-13-12-19(15-23-21)22(2,3)4;/h3-8,10-15H,1-2H3;5-10,12-15H,1-4H3;/q2*-1;/i15D;; |
| InChIKey | ZNQLMRXSUYPMMW-BSRYWEDOSA-N |
| XLogP | 11.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.64 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|