C29H29GeNS — CID 164832502
trimethyl-[4-[6-(4-propan-2-yl-2-pyridinyl)dibenzothiophen-3-yl]phenyl]germane (PubChem CID 164832502) has the molecular formula C29H29GeNS and a molecular weight of 496.24 g/mol. Its IUPAC name is trimethyl-[4-[6-(4-propan-2-yl-2-pyridinyl)dibenzothiophen-3-yl]phenyl]germane.
| Compound Name | trimethyl-[4-[6-(4-propan-2-yl-2-pyridinyl)dibenzothiophen-3-yl]phenyl]germane |
|---|---|
| PubChem CID | 164832502 |
| Molecular Formula | C29H29GeNS |
| Molecular Weight | 496.24 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | trimethyl-[4-[6-(4-propan-2-yl-2-pyridinyl)dibenzothiophen-3-yl]phenyl]germane |
| SMILES | CC(C)c1ccnc(-c2cccc3c2sc2cc(-c4ccc([Ge](C)(C)C)cc4)ccc23)c1 |
| InChI | InChI=1S/C29H29GeNS/c1-19(2)21-15-16-31-27(17-21)26-8-6-7-25-24-14-11-22(18-28(24)32-29(25)26)20-9-12-23(13-10-20)30(3,4)5/h6-19H,1-5H3 |
| InChIKey | YROKALRPSVWEDE-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.24 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |