C23H25GeNS — CID 165170806
[6-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]dibenzothiophen-4-yl]-trimethylgermane (PubChem CID 165170806) has the molecular formula C23H25GeNS and a molecular weight of 421.14 g/mol. Its IUPAC name is [6-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]dibenzothiophen-4-yl]-trimethylgermane.
| Compound Name | [6-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]dibenzothiophen-4-yl]-trimethylgermane |
|---|---|
| PubChem CID | 165170806 |
| Molecular Formula | C23H25GeNS |
| Molecular Weight | 421.14 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [6-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]dibenzothiophen-4-yl]-trimethylgermane |
| SMILES | [2H]C(C)(C)c1ccnc(-c2cccc3c2sc2c([Ge](C)(C)C)cccc23)c1 |
| InChI | InChI=1S/C23H25GeNS/c1-15(2)16-12-13-25-21(14-16)19-10-6-8-17-18-9-7-11-20(24(3,4)5)23(18)26-22(17)19/h6-15H,1-5H3/i15D |
| InChIKey | GCRNOCHQTDIKHV-RWFJLFJASA-N |
| XLogP | 6.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.14 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |