C27H23NS — CID 165171093
4-(2-deuteriopropan-2-yl)-2-[7-(4-methylphenyl)dibenzothiophen-4-yl]pyridine (PubChem CID 165171093) has the molecular formula C27H23NS and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-(2-deuteriopropan-2-yl)-2-[7-(4-methylphenyl)dibenzothiophen-4-yl]pyridine.
| Compound Name | 4-(2-deuteriopropan-2-yl)-2-[7-(4-methylphenyl)dibenzothiophen-4-yl]pyridine |
|---|---|
| PubChem CID | 165171093 |
| Molecular Formula | C27H23NS |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-(2-deuteriopropan-2-yl)-2-[7-(4-methylphenyl)dibenzothiophen-4-yl]pyridine |
| SMILES | [2H]C(C)(C)c1ccnc(-c2cccc3c2sc2cc(-c4ccc(C)cc4)ccc23)c1 |
| InChI | InChI=1S/C27H23NS/c1-17(2)20-13-14-28-25(15-20)24-6-4-5-23-22-12-11-21(16-26(22)29-27(23)24)19-9-7-18(3)8-10-19/h4-17H,1-3H3/i17D |
| InChIKey | UJBJHAFERBMUEE-OKWSDYJOSA-N |
| XLogP | 8.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |