C42H40IrN2OSi-2 — CID 162708986
[4-(1-deuterio-1-phenylethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;4-(2-deuteriopropan-2-yl)-2-(3H-dibenzofuran-3-id-2-yl)pyridine;iridium (PubChem CID 162708986) has the molecular formula C42H40IrN2OSi-2 and a molecular weight of 811.11 g/mol. Its IUPAC name is [4-(1-deuterio-1-phenylethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;4-(2-deuteriopropan-2-yl)-2-(3H-dibenzofuran-3-id-2-yl)pyridine;iridium.
| Compound Name | [4-(1-deuterio-1-phenylethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;4-(2-deuteriopropan-2-yl)-2-(3H-dibenzofuran-3-id-2-yl)pyridine;iridium |
|---|---|
| PubChem CID | 162708986 |
| Molecular Formula | C42H40IrN2OSi-2 |
| Molecular Weight | 811.11 g/mol |
| Exact Mass | 811.27 |
| IUPAC Name | [4-(1-deuterio-1-phenylethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;4-(2-deuteriopropan-2-yl)-2-(3H-dibenzofuran-3-id-2-yl)pyridine;iridium |
| SMILES | [2H]C(C)(C)c1ccnc(-c2[c-]cc3oc4ccccc4c3c2)c1.[2H]C(C)(c1ccccc1)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C22H24NSi.C20H16NO.Ir/c1-17(18-11-7-5-8-12-18)20-15-21(19-13-9-6-10-14-19)23-16-22(20)24(2,3)4;1-13(2)14-9-10-21-18(12-14)15-7-8-20-17(11-15)16-5-3-4-6-19(16)22-20;/h5-13,15-17H,1-4H3;3-6,8-13H,1-2H3;/q2*-1;/i17D;13D; |
| InChIKey | YCAKWBBYJLGAJY-SJJLWQNNSA-N |
| XLogP | 10.81 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.11 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|