C43H41FIrN2OSi-2 — CID 169038963
[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-[8-(4-fluorophenyl)-3H-dibenzofuran-3-id-2-yl]-4-propan-2-ylpyridine;iridium (PubChem CID 169038963) has the molecular formula C43H41FIrN2OSi-2 and a molecular weight of 842.12 g/mol. Its IUPAC name is [4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-[8-(4-fluorophenyl)-3H-dibenzofuran-3-id-2-yl]-4-propan-2-ylpyridine;iridium.
| Compound Name | [4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-[8-(4-fluorophenyl)-3H-dibenzofuran-3-id-2-yl]-4-propan-2-ylpyridine;iridium |
|---|---|
| PubChem CID | 169038963 |
| Molecular Formula | C43H41FIrN2OSi-2 |
| Molecular Weight | 842.12 g/mol |
| Exact Mass | 842.27 |
| IUPAC Name | [4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-[8-(4-fluorophenyl)-3H-dibenzofuran-3-id-2-yl]-4-propan-2-ylpyridine;iridium |
| SMILES | CC(C)c1ccnc(-c2[c-]cc3oc4ccc(-c5ccc(F)cc5)cc4c3c2)c1.[2H]C(C)(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C26H19FNO.C17H22NSi.Ir/c1-16(2)18-11-12-28-24(15-18)20-6-10-26-23(14-20)22-13-19(5-9-25(22)29-26)17-3-7-21(27)8-4-17;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h3-5,7-16H,1-2H3;6-9,11-13H,1-5H3;/q2*-1;/i;13D; |
| InChIKey | XSMAHIAOEPPTHL-LTBAMTPYSA-N |
| XLogP | 11.59 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.12 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|