C43H39F3IrN2OSi-2 — CID 169039041
iridium;4-pentan-3-yl-2-[8-(3,4,5-trifluorophenyl)-3H-dibenzofuran-3-id-2-yl]pyridine;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane (PubChem CID 169039041) has the molecular formula C43H39F3IrN2OSi-2 and a molecular weight of 877.09 g/mol. Its IUPAC name is iridium;4-pentan-3-yl-2-[8-(3,4,5-trifluorophenyl)-3H-dibenzofuran-3-id-2-yl]pyridine;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;4-pentan-3-yl-2-[8-(3,4,5-trifluorophenyl)-3H-dibenzofuran-3-id-2-yl]pyridine;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 169039041 |
| Molecular Formula | C43H39F3IrN2OSi-2 |
| Molecular Weight | 877.09 g/mol |
| Exact Mass | 877.24 |
| IUPAC Name | iridium;4-pentan-3-yl-2-[8-(3,4,5-trifluorophenyl)-3H-dibenzofuran-3-id-2-yl]pyridine;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
| SMILES | CCC(CC)c1ccnc(-c2[c-]cc3oc4ccc(-c5cc(F)c(F)c(F)c5)cc4c3c2)c1.Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C28H21F3NO.C15H18NSi.Ir/c1-3-16(4-2)18-9-10-32-25(15-18)19-6-8-27-22(12-19)21-11-17(5-7-26(21)33-27)20-13-23(29)28(31)24(30)14-20;1-12-10-14(13-8-6-5-7-9-13)16-11-15(12)17(2,3)4;/h5,7-16H,3-4H2,1-2H3;5-8,10-11H,1-4H3;/q2*-1; |
| InChIKey | MUBRVOKJYRYOLA-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.09 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|