C38H39FIrN2OSi-2 — CID 164711932
4-tert-butyl-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 164711932) has the molecular formula C38H39FIrN2OSi-2 and a molecular weight of 780.05 g/mol. Its IUPAC name is 4-tert-butyl-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 4-tert-butyl-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 164711932 |
| Molecular Formula | C38H39FIrN2OSi-2 |
| Molecular Weight | 780.05 g/mol |
| Exact Mass | 780.25 |
| IUPAC Name | 4-tert-butyl-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]ccc3c2oc2cc(F)ccc23)c1.[2H]C(C)(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C21H17FNO.C17H22NSi.Ir/c1-21(2,3)13-9-10-23-18(11-13)17-6-4-5-16-15-8-7-14(22)12-19(15)24-20(16)17;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h4-5,7-12H,1-3H3;6-9,11-13H,1-5H3;/q2*-1;/i;13D; |
| InChIKey | WNFUKLYPHUSFGJ-LTBAMTPYSA-N |
| XLogP | 10.10 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.05 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|